About 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol
5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol (PubChem CID 71968069) has the molecular formula C17H19N3O3
and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol.
Molecular Properties
| Compound Name | 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol |
| PubChem CID | 71968069 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol |
| SMILES | COc1ccc(CNc2ccc3nc(N(C)C)oc3c2)cc1O |
| InChI | InChI=1S/C17H19N3O3/c1-20(2)17-19-13-6-5-12(9-16(13)23-17)18-10-11-4-7-15(22-3)14(21)8-11/h4-9,18,21H,10H2,1-3H3 |
| InChIKey | AFIYGBDFWAOPJC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol?
The IUPAC name of 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol (CID 71968069) is 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol.
What is the SMILES notation for 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol?
The canonical SMILES for 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol is COc1ccc(CNc2ccc3nc(N(C)C)oc3c2)cc1O.
What is the InChIKey of 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol?
The InChIKey is AFIYGBDFWAOPJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3/c1-20(2)17-19-13-6-5-12(9-16(13)23-17)18-10-11-4-7-15(22-3)14(21)8-11/h4-9,18,21H,10H2,1-3H3.
What are the key properties of 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol?
5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol has a molecular weight of 313.36 g/mol, XLogP of 3.22, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[[2-(dimethylamino)-1,3-benzoxazol-6-yl]amino]methyl]-2-methoxyphenol is sourced from PubChem (CID 71968069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).