About 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane
9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane (PubChem CID 71968456) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane |
| PubChem CID | 71968456 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane |
| SMILES | Cc1nc(CN2CCOC3(CCCC3)C2)oc1C |
| InChI | InChI=1S/C14H22N2O2/c1-11-12(2)18-13(15-11)9-16-7-8-17-14(10-16)5-3-4-6-14/h3-10H2,1-2H3 |
| InChIKey | VNIPMUIMQGKCKR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane?
The IUPAC name of 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane (CID 71968456) is 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane.
What is the SMILES notation for 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane?
The canonical SMILES for 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane is Cc1nc(CN2CCOC3(CCCC3)C2)oc1C.
What is the InChIKey of 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane?
The InChIKey is VNIPMUIMQGKCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-11-12(2)18-13(15-11)9-16-7-8-17-14(10-16)5-3-4-6-14/h3-10H2,1-2H3.
What are the key properties of 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane?
9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane has a molecular weight of 250.34 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-6-oxa-9-azaspiro[4.5]decane is sourced from PubChem (CID 71968456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).