C14H20F3N3S — CID 71968545
2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 71968545) has the molecular formula C14H20F3N3S and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 71968545 |
| Molecular Formula | C14H20F3N3S |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | Cc1nc2c(s1)C(NC1CCN(CC(F)(F)F)C1)CCC2 |
| InChI | InChI=1S/C14H20F3N3S/c1-9-18-11-3-2-4-12(13(11)21-9)19-10-5-6-20(7-10)8-14(15,16)17/h10,12,19H,2-8H2,1H3 |
| InChIKey | UCKITJSSOUWCIV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |