About N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine
N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine (PubChem CID 71968702) has the molecular formula C17H22N2O
and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine.
Molecular Properties
| Compound Name | N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine |
| PubChem CID | 71968702 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine |
| SMILES | Cc1cc(CNC2(c3ccccc3)CCCCC2)no1 |
| InChI | InChI=1S/C17H22N2O/c1-14-12-16(19-20-14)13-18-17(10-6-3-7-11-17)15-8-4-2-5-9-15/h2,4-5,8-9,12,18H,3,6-7,10-11,13H2,1H3 |
| InChIKey | IWMOYETXXKNSCK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine?
The IUPAC name of N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine (CID 71968702) is N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine.
What is the SMILES notation for N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine?
The canonical SMILES for N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine is Cc1cc(CNC2(c3ccccc3)CCCCC2)no1.
What is the InChIKey of N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine?
The InChIKey is IWMOYETXXKNSCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c1-14-12-16(19-20-14)13-18-17(10-6-3-7-11-17)15-8-4-2-5-9-15/h2,4-5,8-9,12,18H,3,6-7,10-11,13H2,1H3.
What are the key properties of N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine?
N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine has a molecular weight of 270.38 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-phenylcyclohexan-1-amine is sourced from PubChem (CID 71968702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).