C12H18N4OS2 — CID 71968791
N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide (PubChem CID 71968791) has the molecular formula C12H18N4OS2 and a molecular weight of 298.44 g/mol. Its IUPAC name is N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide.
| Compound Name | N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
|---|---|
| PubChem CID | 71968791 |
| Molecular Formula | C12H18N4OS2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
| SMILES | CSc1nsc(NC(=O)N2CCC3CCCCC32)n1 |
| InChI | InChI=1S/C12H18N4OS2/c1-18-11-13-10(19-15-11)14-12(17)16-7-6-8-4-2-3-5-9(8)16/h8-9H,2-7H2,1H3,(H,13,14,15,17) |
| InChIKey | JUVPGMAJQXSSEQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |