C12H13F3N4OS — CID 71968847
N-[3-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanylpropyl]-2,2,2-trifluoroacetamide (PubChem CID 71968847) has the molecular formula C12H13F3N4OS and a molecular weight of 318.32 g/mol. Its IUPAC name is N-[3-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanylpropyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanylpropyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 71968847 |
| Molecular Formula | C12H13F3N4OS |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[3-(5-cyano-2,6-dimethylpyrimidin-4-yl)sulfanylpropyl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1nc(C)c(C#N)c(SCCCNC(=O)C(F)(F)F)n1 |
| InChI | InChI=1S/C12H13F3N4OS/c1-7-9(6-16)10(19-8(2)18-7)21-5-3-4-17-11(20)12(13,14)15/h3-5H2,1-2H3,(H,17,20) |
| InChIKey | GIOLUYOJNKLOIZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|