About methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate
methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate (PubChem CID 71969485) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate |
| PubChem CID | 71969485 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate |
| SMILES | COC(=O)[C@@H](NCc1cccc(C#N)c1)C(C)(C)C |
| InChI | InChI=1S/C15H20N2O2/c1-15(2,3)13(14(18)19-4)17-10-12-7-5-6-11(8-12)9-16/h5-8,13,17H,10H2,1-4H3/t13-/m1/s1 |
| InChIKey | KGEPEZHERGIMMS-CYBMUJFWSA-N |
| XLogP | 2.24 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate?
The IUPAC name of methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate (CID 71969485) is methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate.
What is the SMILES notation for methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate?
The canonical SMILES for methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate is COC(=O)[C@@H](NCc1cccc(C#N)c1)C(C)(C)C.
What is the InChIKey of methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate?
The InChIKey is KGEPEZHERGIMMS-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-15(2,3)13(14(18)19-4)17-10-12-7-5-6-11(8-12)9-16/h5-8,13,17H,10H2,1-4H3/t13-/m1/s1.
What are the key properties of methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate?
methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate has a molecular weight of 260.34 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[(3-cyanophenyl)methylamino]-3,3-dimethylbutanoate is sourced from PubChem (CID 71969485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).