C22H24N2O4S — CID 7196977
(3-cyanophenyl)methyl 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 7196977) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is (3-cyanophenyl)methyl 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | (3-cyanophenyl)methyl 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 7196977 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (3-cyanophenyl)methyl 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | C[C@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(C(=O)OCc3cccc(C#N)c3)cc2)C1 |
| InChI | InChI=1S/C22H24N2O4S/c1-16-10-17(2)14-24(13-16)29(26,27)21-8-6-20(7-9-21)22(25)28-15-19-5-3-4-18(11-19)12-23/h3-9,11,16-17H,10,13-15H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | BHWTZSTYXGXHSI-IRXDYDNUSA-N |
| XLogP | 3.58 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |