About 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide
1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide (PubChem CID 71969893) has the molecular formula C9H17N3O2S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide |
| PubChem CID | 71969893 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide |
| SMILES | CCC(C)n1cnc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C9H17N3O2S/c1-5-8(2)12-6-9(10-7-12)15(13,14)11(3)4/h6-8H,5H2,1-4H3 |
| InChIKey | UTMXRGDOXNBZBW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide?
The IUPAC name of 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide (CID 71969893) is 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide.
What is the SMILES notation for 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide?
The canonical SMILES for 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide is CCC(C)n1cnc(S(=O)(=O)N(C)C)c1.
What is the InChIKey of 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide?
The InChIKey is UTMXRGDOXNBZBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2S/c1-5-8(2)12-6-9(10-7-12)15(13,14)11(3)4/h6-8H,5H2,1-4H3.
What are the key properties of 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide?
1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide has a molecular weight of 231.32 g/mol, XLogP of 1.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-N,N-dimethylimidazole-4-sulfonamide is sourced from PubChem (CID 71969893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).