C12H18N6OS — CID 71969900
3-ethyl-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1,2,4-thiadiazol-5-amine (PubChem CID 71969900) has the molecular formula C12H18N6OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-ethyl-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-ethyl-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 71969900 |
| Molecular Formula | C12H18N6OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-ethyl-N-[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(NC2CCCn3nc(COC)nc32)n1 |
| InChI | InChI=1S/C12H18N6OS/c1-3-9-15-12(20-17-9)13-8-5-4-6-18-11(8)14-10(16-18)7-19-2/h8H,3-7H2,1-2H3,(H,13,15,17) |
| InChIKey | UIXMNSCVYPPLJM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |