About (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide
(2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide (PubChem CID 71969908) has the molecular formula C16H27N5O2
and a molecular weight of 321.43 g/mol. Its IUPAC name is (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide.
Molecular Properties
| Compound Name | (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide |
| PubChem CID | 71969908 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide |
| SMILES | CC(C)NC(=O)N1CCC[C@H]1C(=O)NCCCc1cnn(C)c1 |
| InChI | InChI=1S/C16H27N5O2/c1-12(2)19-16(23)21-9-5-7-14(21)15(22)17-8-4-6-13-10-18-20(3)11-13/h10-12,14H,4-9H2,1-3H3,(H,17,22)(H,19,23)/t14-/m0/s1 |
| InChIKey | PBMLPJJVRWRSSB-AWEZNQCLSA-N |
| XLogP | 1.05 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide?
The IUPAC name of (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide (CID 71969908) is (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide.
What is the SMILES notation for (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide?
The canonical SMILES for (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide is CC(C)NC(=O)N1CCC[C@H]1C(=O)NCCCc1cnn(C)c1.
What is the InChIKey of (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide?
The InChIKey is PBMLPJJVRWRSSB-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H27N5O2/c1-12(2)19-16(23)21-9-5-7-14(21)15(22)17-8-4-6-13-10-18-20(3)11-13/h10-12,14H,4-9H2,1-3H3,(H,17,22)(H,19,23)/t14-/m0/s1.
What are the key properties of (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide?
(2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide has a molecular weight of 321.43 g/mol, XLogP of 1.05, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-N-[3-(1-methylpyrazol-4-yl)propyl]-1-N-propan-2-ylpyrrolidine-1,2-dicarboxamide is sourced from PubChem (CID 71969908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).