About (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate
(3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate (PubChem CID 7197005) has the molecular formula C13H14N2O5S
and a molecular weight of 310.33 g/mol. Its IUPAC name is (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate.
Molecular Properties
| Compound Name | (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate |
| PubChem CID | 7197005 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate |
| SMILES | Cc1cccc(OS(=O)(=O)c2cn(C)c(=O)n(C)c2=O)c1 |
| InChI | InChI=1S/C13H14N2O5S/c1-9-5-4-6-10(7-9)20-21(18,19)11-8-14(2)13(17)15(3)12(11)16/h4-8H,1-3H3 |
| InChIKey | XMJURYCLLKRWMO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate?
The IUPAC name of (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate (CID 7197005) is (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate.
What is the SMILES notation for (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate?
The canonical SMILES for (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate is Cc1cccc(OS(=O)(=O)c2cn(C)c(=O)n(C)c2=O)c1.
What is the InChIKey of (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate?
The InChIKey is XMJURYCLLKRWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O5S/c1-9-5-4-6-10(7-9)20-21(18,19)11-8-14(2)13(17)15(3)12(11)16/h4-8H,1-3H3.
What are the key properties of (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate?
(3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate has a molecular weight of 310.33 g/mol, XLogP of 0.16, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl) 1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonate is sourced from PubChem (CID 7197005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).