C19H20N4O — CID 71970391
6-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)pyridine-3-carbonitrile (PubChem CID 71970391) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 6-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)pyridine-3-carbonitrile.
| Compound Name | 6-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71970391 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 6-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CC3OCCN(Cc4ccccc4)C3C2)nc1 |
| InChI | InChI=1S/C19H20N4O/c20-10-16-6-7-19(21-11-16)23-13-17-18(14-23)24-9-8-22(17)12-15-4-2-1-3-5-15/h1-7,11,17-18H,8-9,12-14H2 |
| InChIKey | TZJZMUHFRLOCKJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |