C12H11F2N3OS — CID 71970392
3-[(2,4-difluorophenyl)methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one (PubChem CID 71970392) has the molecular formula C12H11F2N3OS and a molecular weight of 283.30 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(2,4-difluorophenyl)methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 71970392 |
| Molecular Formula | C12H11F2N3OS |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methylsulfanyl]-4-prop-2-enyl-1H-1,2,4-triazol-5-one |
| SMILES | C=CCn1c(SCc2ccc(F)cc2F)n[nH]c1=O |
| InChI | InChI=1S/C12H11F2N3OS/c1-2-5-17-11(18)15-16-12(17)19-7-8-3-4-9(13)6-10(8)14/h2-4,6H,1,5,7H2,(H,15,18) |
| InChIKey | IJBJDOAQYYTMHB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|