About 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one
3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one (PubChem CID 71971182) has the molecular formula C16H15N5O
and a molecular weight of 293.33 g/mol. Its IUPAC name is 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one.
Molecular Properties
| Compound Name | 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one |
| PubChem CID | 71971182 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one |
| SMILES | O=c1c2cnn(-c3ccccc3)c2nnn1C1C=CCCC1 |
| InChI | InChI=1S/C16H15N5O/c22-16-14-11-17-20(12-7-3-1-4-8-12)15(14)18-19-21(16)13-9-5-2-6-10-13/h1,3-5,7-9,11,13H,2,6,10H2 |
| InChIKey | AAXYDCBQBAREAG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one?
The IUPAC name of 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one (CID 71971182) is 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one.
What is the SMILES notation for 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one?
The canonical SMILES for 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one is O=c1c2cnn(-c3ccccc3)c2nnn1C1C=CCCC1.
What is the InChIKey of 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one?
The InChIKey is AAXYDCBQBAREAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O/c22-16-14-11-17-20(12-7-3-1-4-8-12)15(14)18-19-21(16)13-9-5-2-6-10-13/h1,3-5,7-9,11,13H,2,6,10H2.
What are the key properties of 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one?
3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one has a molecular weight of 293.33 g/mol, XLogP of 2.26, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohex-2-en-1-yl-7-phenylpyrazolo[5,4-d]triazin-4-one is sourced from PubChem (CID 71971182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).