About 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole
3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole (PubChem CID 71971376) has the molecular formula C9H9N3O2S
and a molecular weight of 223.26 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole |
| PubChem CID | 71971376 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole |
| SMILES | c1nc(-c2nc(C3CCOC3)no2)cs1 |
| InChI | InChI=1S/C9H9N3O2S/c1-2-13-3-6(1)8-11-9(14-12-8)7-4-15-5-10-7/h4-6H,1-3H2 |
| InChIKey | GMMRKLHDVSCJCC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole?
The IUPAC name of 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole (CID 71971376) is 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole?
The canonical SMILES for 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole is c1nc(-c2nc(C3CCOC3)no2)cs1.
What is the InChIKey of 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole?
The InChIKey is GMMRKLHDVSCJCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2S/c1-2-13-3-6(1)8-11-9(14-12-8)7-4-15-5-10-7/h4-6H,1-3H2.
What are the key properties of 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole?
3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole has a molecular weight of 223.26 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxolan-3-yl)-5-(1,3-thiazol-4-yl)-1,2,4-oxadiazole is sourced from PubChem (CID 71971376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).