C13H20N2O3S — CID 71971734
4-ethoxy-N,N-dimethyl-3-(prop-2-enylamino)benzenesulfonamide (PubChem CID 71971734) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 4-ethoxy-N,N-dimethyl-3-(prop-2-enylamino)benzenesulfonamide.
| Compound Name | 4-ethoxy-N,N-dimethyl-3-(prop-2-enylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 71971734 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-ethoxy-N,N-dimethyl-3-(prop-2-enylamino)benzenesulfonamide |
| SMILES | C=CCNc1cc(S(=O)(=O)N(C)C)ccc1OCC |
| InChI | InChI=1S/C13H20N2O3S/c1-5-9-14-12-10-11(19(16,17)15(3)4)7-8-13(12)18-6-2/h5,7-8,10,14H,1,6,9H2,2-4H3 |
| InChIKey | XOUOGTXIXSPKSO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|