About 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine
2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine (PubChem CID 71971923) has the molecular formula C13H15N3O2S2
and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine.
Molecular Properties
| Compound Name | 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine |
| PubChem CID | 71971923 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine |
| SMILES | CC1CN(S(=O)(=O)c2cn(C)cn2)c2ccccc2S1 |
| InChI | InChI=1S/C13H15N3O2S2/c1-10-7-16(11-5-3-4-6-12(11)19-10)20(17,18)13-8-15(2)9-14-13/h3-6,8-10H,7H2,1-2H3 |
| InChIKey | SCJDBXRVIBNUHT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine?
The IUPAC name of 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine (CID 71971923) is 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine.
What is the SMILES notation for 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine?
The canonical SMILES for 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine is CC1CN(S(=O)(=O)c2cn(C)cn2)c2ccccc2S1.
What is the InChIKey of 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine?
The InChIKey is SCJDBXRVIBNUHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2S2/c1-10-7-16(11-5-3-4-6-12(11)19-10)20(17,18)13-8-15(2)9-14-13/h3-6,8-10H,7H2,1-2H3.
What are the key properties of 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine?
2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine has a molecular weight of 309.42 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(1-methylimidazol-4-yl)sulfonyl-2,3-dihydro-1,4-benzothiazine is sourced from PubChem (CID 71971923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).