About N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide
N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide (PubChem CID 71971989) has the molecular formula C14H18N2O3S2
and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide |
| PubChem CID | 71971989 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide |
| SMILES | Cc1nc(COc2ccc(N(C)S(C)(=O)=O)cc2)sc1C |
| InChI | InChI=1S/C14H18N2O3S2/c1-10-11(2)20-14(15-10)9-19-13-7-5-12(6-8-13)16(3)21(4,17)18/h5-8H,9H2,1-4H3 |
| InChIKey | YCWGIKFZSVFROW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide?
The IUPAC name of N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide (CID 71971989) is N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide is Cc1nc(COc2ccc(N(C)S(C)(=O)=O)cc2)sc1C.
What is the InChIKey of N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide?
The InChIKey is YCWGIKFZSVFROW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3S2/c1-10-11(2)20-14(15-10)9-19-13-7-5-12(6-8-13)16(3)21(4,17)18/h5-8H,9H2,1-4H3.
What are the key properties of N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide?
N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide has a molecular weight of 326.44 g/mol, XLogP of 2.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methoxy]phenyl]-N-methylmethanesulfonamide is sourced from PubChem (CID 71971989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).