C15H13N5O2S2 — CID 7197224
7-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3-methyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one (PubChem CID 7197224) has the molecular formula C15H13N5O2S2 and a molecular weight of 359.44 g/mol. Its IUPAC name is 7-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3-methyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one.
| Compound Name | 7-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3-methyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 7197224 |
| Molecular Formula | C15H13N5O2S2 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 7-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-3-methyl-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
| SMILES | Cc1nnc2sc(SCC(=O)N3CCc4ccccc43)nn2c1=O |
| InChI | InChI=1S/C15H13N5O2S2/c1-9-13(22)20-14(17-16-9)24-15(18-20)23-8-12(21)19-7-6-10-4-2-3-5-11(10)19/h2-5H,6-8H2,1H3 |
| InChIKey | YTWVBZBHIPFFQN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |