About 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide
1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide (PubChem CID 71972548) has the molecular formula C18H29N3O3
and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide |
| PubChem CID | 71972548 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide |
| SMILES | CCc1noc(CC)c1CC(=O)N1CCC(C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C18H29N3O3/c1-5-15-14(16(6-2)24-20-15)11-17(22)21-9-7-13(8-10-21)18(23)19-12(3)4/h12-13H,5-11H2,1-4H3,(H,19,23) |
| InChIKey | DMBULSYELQCFIE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide?
The IUPAC name of 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide (CID 71972548) is 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide.
What is the SMILES notation for 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide?
The canonical SMILES for 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide is CCc1noc(CC)c1CC(=O)N1CCC(C(=O)NC(C)C)CC1.
What is the InChIKey of 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide?
The InChIKey is DMBULSYELQCFIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O3/c1-5-15-14(16(6-2)24-20-15)11-17(22)21-9-7-13(8-10-21)18(23)19-12(3)4/h12-13H,5-11H2,1-4H3,(H,19,23).
What are the key properties of 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide?
1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide has a molecular weight of 335.45 g/mol, XLogP of 2.11, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,5-diethyl-1,2-oxazol-4-yl)acetyl]-N-propan-2-ylpiperidine-4-carboxamide is sourced from PubChem (CID 71972548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).