About 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea
1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea (PubChem CID 71972681) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea.
Molecular Properties
| Compound Name | 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea |
| PubChem CID | 71972681 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea |
| SMILES | CCNC(=O)NCc1c(CC)noc1CC |
| InChI | InChI=1S/C11H19N3O2/c1-4-9-8(10(5-2)16-14-9)7-13-11(15)12-6-3/h4-7H2,1-3H3,(H2,12,13,15) |
| InChIKey | MWJZPZZHGOQFTP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea?
The IUPAC name of 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea (CID 71972681) is 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea.
What is the SMILES notation for 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea?
The canonical SMILES for 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea is CCNC(=O)NCc1c(CC)noc1CC.
What is the InChIKey of 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea?
The InChIKey is MWJZPZZHGOQFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2/c1-4-9-8(10(5-2)16-14-9)7-13-11(15)12-6-3/h4-7H2,1-3H3,(H2,12,13,15).
What are the key properties of 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea?
1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea has a molecular weight of 225.29 g/mol, XLogP of 1.62, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-3-ethylurea is sourced from PubChem (CID 71972681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).