C12H18N4O2S2 — CID 71972691
3-[(4,5-dimethyl-1,3-thiazol-2-yl)methylsulfanyl]-4-(3-methoxypropyl)-1H-1,2,4-triazol-5-one (PubChem CID 71972691) has the molecular formula C12H18N4O2S2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methylsulfanyl]-4-(3-methoxypropyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methylsulfanyl]-4-(3-methoxypropyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 71972691 |
| Molecular Formula | C12H18N4O2S2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methylsulfanyl]-4-(3-methoxypropyl)-1H-1,2,4-triazol-5-one |
| SMILES | COCCCn1c(SCc2nc(C)c(C)s2)n[nH]c1=O |
| InChI | InChI=1S/C12H18N4O2S2/c1-8-9(2)20-10(13-8)7-19-12-15-14-11(17)16(12)5-4-6-18-3/h4-7H2,1-3H3,(H,14,17) |
| InChIKey | ZNPJRDQWMMIKAZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|