C16H21N3O2 — CID 71973092
N-(2-methoxyphenyl)-1-(1,2-oxazol-3-ylmethyl)piperidin-4-amine (PubChem CID 71973092) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-1-(1,2-oxazol-3-ylmethyl)piperidin-4-amine.
| Compound Name | N-(2-methoxyphenyl)-1-(1,2-oxazol-3-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 71973092 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-(2-methoxyphenyl)-1-(1,2-oxazol-3-ylmethyl)piperidin-4-amine |
| SMILES | COc1ccccc1NC1CCN(Cc2ccon2)CC1 |
| InChI | InChI=1S/C16H21N3O2/c1-20-16-5-3-2-4-15(16)17-13-6-9-19(10-7-13)12-14-8-11-21-18-14/h2-5,8,11,13,17H,6-7,9-10,12H2,1H3 |
| InChIKey | RWZFWBZXNLWFMG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |