About 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide
5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide (PubChem CID 71973333) has the molecular formula C17H22FN3O2
and a molecular weight of 319.38 g/mol. Its IUPAC name is 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide |
| PubChem CID | 71973333 |
| Molecular Formula | C17H22FN3O2 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(NCc2ncc(C(C)(C)C)o2)ccc1F |
| InChI | InChI=1S/C17H22FN3O2/c1-17(2,3)14-9-20-15(23-14)10-19-11-6-7-13(18)12(8-11)16(22)21(4)5/h6-9,19H,10H2,1-5H3 |
| InChIKey | KYDZWFWQUZKLBK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide?
The IUPAC name of 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide (CID 71973333) is 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide.
What is the SMILES notation for 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide?
The canonical SMILES for 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide is CN(C)C(=O)c1cc(NCc2ncc(C(C)(C)C)o2)ccc1F.
What is the InChIKey of 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide?
The InChIKey is KYDZWFWQUZKLBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22FN3O2/c1-17(2,3)14-9-20-15(23-14)10-19-11-6-7-13(18)12(8-11)16(22)21(4)5/h6-9,19H,10H2,1-5H3.
What are the key properties of 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide?
5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide has a molecular weight of 319.38 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-2-fluoro-N,N-dimethylbenzamide is sourced from PubChem (CID 71973333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).