About 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide
2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide (PubChem CID 71973341) has the molecular formula C16H20FN3O2
and a molecular weight of 305.35 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide.
Molecular Properties
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide |
| PubChem CID | 71973341 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide |
| SMILES | Cc1cc(NCc2ncc(C(C)(C)C)o2)c(C(N)=O)cc1F |
| InChI | InChI=1S/C16H20FN3O2/c1-9-5-12(10(15(18)21)6-11(9)17)19-8-14-20-7-13(22-14)16(2,3)4/h5-7,19H,8H2,1-4H3,(H2,18,21) |
| InChIKey | ZDCQSCSIAUZXGV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide?
The IUPAC name of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide (CID 71973341) is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide.
What is the SMILES notation for 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide?
The canonical SMILES for 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide is Cc1cc(NCc2ncc(C(C)(C)C)o2)c(C(N)=O)cc1F.
What is the InChIKey of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide?
The InChIKey is ZDCQSCSIAUZXGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20FN3O2/c1-9-5-12(10(15(18)21)6-11(9)17)19-8-14-20-7-13(22-14)16(2,3)4/h5-7,19H,8H2,1-4H3,(H2,18,21).
What are the key properties of 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide?
2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide has a molecular weight of 305.35 g/mol, XLogP of 3.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-tert-butyl-1,3-oxazol-2-yl)methylamino]-5-fluoro-4-methylbenzamide is sourced from PubChem (CID 71973341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).