C16H9F3N4O2 — CID 71973445
3-pyrimidin-2-yl-4-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]-1,2,4-oxadiazol-5-one (PubChem CID 71973445) has the molecular formula C16H9F3N4O2 and a molecular weight of 346.27 g/mol. Its IUPAC name is 3-pyrimidin-2-yl-4-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]-1,2,4-oxadiazol-5-one.
| Compound Name | 3-pyrimidin-2-yl-4-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 71973445 |
| Molecular Formula | C16H9F3N4O2 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 3-pyrimidin-2-yl-4-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]-1,2,4-oxadiazol-5-one |
| SMILES | O=c1onc(-c2ncccn2)n1CC#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H9F3N4O2/c17-16(18,19)12-6-4-11(5-7-12)3-1-10-23-14(22-25-15(23)24)13-20-8-2-9-21-13/h2,4-9H,10H2 |
| InChIKey | GEFGVUHIJLZNMI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|