C13H14O6 — CID 719735
dimethyl (4S,5S)-2-phenyl-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 719735) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is dimethyl (4S,5S)-2-phenyl-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dimethyl (4S,5S)-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 719735 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | dimethyl (4S,5S)-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | COC(=O)[C@H]1OC(c2ccccc2)O[C@@H]1C(=O)OC |
| InChI | InChI=1S/C13H14O6/c1-16-11(14)9-10(12(15)17-2)19-13(18-9)8-6-4-3-5-7-8/h3-7,9-10,13H,1-2H3/t9-,10-/m0/s1 |
| InChIKey | FMSYNRGOFIGJMM-UWVGGRQHSA-N |
| XLogP | 0.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |