About 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate
2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate (PubChem CID 71973721) has the molecular formula C16H14N4O2S
and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate |
| PubChem CID | 71973721 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate |
| SMILES | O=C(OCCNc1ccc(-c2ccccc2)nn1)c1cscn1 |
| InChI | InChI=1S/C16H14N4O2S/c21-16(14-10-23-11-18-14)22-9-8-17-15-7-6-13(19-20-15)12-4-2-1-3-5-12/h1-7,10-11H,8-9H2,(H,17,20) |
| InChIKey | NFIKGKDAVCUQAL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate?
The IUPAC name of 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate (CID 71973721) is 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate.
What is the SMILES notation for 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate?
The canonical SMILES for 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate is O=C(OCCNc1ccc(-c2ccccc2)nn1)c1cscn1.
What is the InChIKey of 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate?
The InChIKey is NFIKGKDAVCUQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O2S/c21-16(14-10-23-11-18-14)22-9-8-17-15-7-6-13(19-20-15)12-4-2-1-3-5-12/h1-7,10-11H,8-9H2,(H,17,20).
What are the key properties of 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate?
2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate has a molecular weight of 326.38 g/mol, XLogP of 2.87, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-phenylpyridazin-3-yl)amino]ethyl 1,3-thiazole-4-carboxylate is sourced from PubChem (CID 71973721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).