About [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol
[4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol (PubChem CID 71973916) has the molecular formula C15H19N3O2S
and a molecular weight of 305.40 g/mol. Its IUPAC name is [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol.
Molecular Properties
| Compound Name | [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol |
| PubChem CID | 71973916 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol |
| SMILES | OCC1(NCc2cnc(-c3ccccn3)s2)CCOCC1 |
| InChI | InChI=1S/C15H19N3O2S/c19-11-15(4-7-20-8-5-15)18-10-12-9-17-14(21-12)13-3-1-2-6-16-13/h1-3,6,9,18-19H,4-5,7-8,10-11H2 |
| InChIKey | HWLVWVRBPKSTOC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol?
The IUPAC name of [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol (CID 71973916) is [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol.
What is the SMILES notation for [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol?
The canonical SMILES for [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol is OCC1(NCc2cnc(-c3ccccn3)s2)CCOCC1.
What is the InChIKey of [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol?
The InChIKey is HWLVWVRBPKSTOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2S/c19-11-15(4-7-20-8-5-15)18-10-12-9-17-14(21-12)13-3-1-2-6-16-13/h1-3,6,9,18-19H,4-5,7-8,10-11H2.
What are the key properties of [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol?
[4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol has a molecular weight of 305.40 g/mol, XLogP of 1.84, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-pyridin-2-yl-1,3-thiazol-5-yl)methylamino]oxan-4-yl]methanol is sourced from PubChem (CID 71973916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).