C13H18F3N3O — CID 71974049
N-cyclohexyl-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide (PubChem CID 71974049) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is N-cyclohexyl-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-cyclohexyl-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 71974049 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-cyclohexyl-N-(3,3,3-trifluoropropyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(c1ccn[nH]1)N(CCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C13H18F3N3O/c14-13(15,16)7-9-19(10-4-2-1-3-5-10)12(20)11-6-8-17-18-11/h6,8,10H,1-5,7,9H2,(H,17,18) |
| InChIKey | VUEFQZMWJSBYHB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |