C17H18ClN3O3 — CID 71974186
1-[(2-chloro-4-methoxyphenyl)methyl]-3-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 71974186) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 1-[(2-chloro-4-methoxyphenyl)methyl]-3-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(2-chloro-4-methoxyphenyl)methyl]-3-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 71974186 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-[(2-chloro-4-methoxyphenyl)methyl]-3-[(1-methylpyrazol-4-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(CN2C(=O)CC(Cc3cnn(C)c3)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-20-9-11(8-19-20)5-13-6-16(22)21(17(13)23)10-12-3-4-14(24-2)7-15(12)18/h3-4,7-9,13H,5-6,10H2,1-2H3 |
| InChIKey | JYMNMXUWXLYTSK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|