C11H13Cl2N5 — CID 71974562
N'-(3,5-dichloro-2-pyridinyl)-N-(1H-pyrazol-5-ylmethyl)ethane-1,2-diamine (PubChem CID 71974562) has the molecular formula C11H13Cl2N5 and a molecular weight of 286.17 g/mol. Its IUPAC name is N'-(3,5-dichloro-2-pyridinyl)-N-(1H-pyrazol-5-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(3,5-dichloro-2-pyridinyl)-N-(1H-pyrazol-5-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 71974562 |
| Molecular Formula | C11H13Cl2N5 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N'-(3,5-dichloro-2-pyridinyl)-N-(1H-pyrazol-5-ylmethyl)ethane-1,2-diamine |
| SMILES | Clc1cnc(NCCNCc2ccn[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2N5/c12-8-5-10(13)11(16-6-8)15-4-3-14-7-9-1-2-17-18-9/h1-2,5-6,14H,3-4,7H2,(H,15,16)(H,17,18) |
| InChIKey | KEDDSRAQSMGSPM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|