About (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate
(4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate (PubChem CID 71974795) has the molecular formula C11H11BrFNO3
and a molecular weight of 304.11 g/mol. Its IUPAC name is (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate |
| PubChem CID | 71974795 |
| Molecular Formula | C11H11BrFNO3 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate |
| SMILES | NC(=O)CCCOC(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H11BrFNO3/c12-7-3-4-8(9(13)6-7)11(16)17-5-1-2-10(14)15/h3-4,6H,1-2,5H2,(H2,14,15) |
| InChIKey | LKSCBPMYUQGRDY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate?
The IUPAC name of (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate (CID 71974795) is (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate.
What is the SMILES notation for (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate?
The canonical SMILES for (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate is NC(=O)CCCOC(=O)c1ccc(Br)cc1F.
What is the InChIKey of (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate?
The InChIKey is LKSCBPMYUQGRDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrFNO3/c12-7-3-4-8(9(13)6-7)11(16)17-5-1-2-10(14)15/h3-4,6H,1-2,5H2,(H2,14,15).
What are the key properties of (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate?
(4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate has a molecular weight of 304.11 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-4-oxobutyl) 4-bromo-2-fluorobenzoate is sourced from PubChem (CID 71974795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).