C18H25N3O3 — CID 71974818
(1-cyclopropylcyclopropyl) 1-[2-(cyclohexylamino)-2-oxoethyl]pyrazole-4-carboxylate (PubChem CID 71974818) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is (1-cyclopropylcyclopropyl) 1-[2-(cyclohexylamino)-2-oxoethyl]pyrazole-4-carboxylate.
| Compound Name | (1-cyclopropylcyclopropyl) 1-[2-(cyclohexylamino)-2-oxoethyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 71974818 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (1-cyclopropylcyclopropyl) 1-[2-(cyclohexylamino)-2-oxoethyl]pyrazole-4-carboxylate |
| SMILES | O=C(Cn1cc(C(=O)OC2(C3CC3)CC2)cn1)NC1CCCCC1 |
| InChI | InChI=1S/C18H25N3O3/c22-16(20-15-4-2-1-3-5-15)12-21-11-13(10-19-21)17(23)24-18(8-9-18)14-6-7-14/h10-11,14-15H,1-9,12H2,(H,20,22) |
| InChIKey | HVFHFECCNIOJGC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |