C13H24F3N3OS — CID 71974909
2,2-dimethyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]thiomorpholine-4-carboxamide (PubChem CID 71974909) has the molecular formula C13H24F3N3OS and a molecular weight of 327.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]thiomorpholine-4-carboxamide.
| Compound Name | 2,2-dimethyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 71974909 |
| Molecular Formula | C13H24F3N3OS |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2,2-dimethyl-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]thiomorpholine-4-carboxamide |
| SMILES | CN(CCCNC(=O)N1CCSC(C)(C)C1)CC(F)(F)F |
| InChI | InChI=1S/C13H24F3N3OS/c1-12(2)9-19(7-8-21-12)11(20)17-5-4-6-18(3)10-13(14,15)16/h4-10H2,1-3H3,(H,17,20) |
| InChIKey | OEVDVIFHOSOKEU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|