About N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide
N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide (PubChem CID 71975447) has the molecular formula C17H27N3O2
and a molecular weight of 305.42 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide |
| PubChem CID | 71975447 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide |
| SMILES | CCOC1CC(N(C)C(=O)c2ccnc(C)n2)C1(CC)CC |
| InChI | InChI=1S/C17H27N3O2/c1-6-17(7-2)14(11-15(17)22-8-3)20(5)16(21)13-9-10-18-12(4)19-13/h9-10,14-15H,6-8,11H2,1-5H3 |
| InChIKey | ZYJFZGCGHLKUMO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide?
The IUPAC name of N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide (CID 71975447) is N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide.
What is the SMILES notation for N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide?
The canonical SMILES for N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide is CCOC1CC(N(C)C(=O)c2ccnc(C)n2)C1(CC)CC.
What is the InChIKey of N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide?
The InChIKey is ZYJFZGCGHLKUMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O2/c1-6-17(7-2)14(11-15(17)22-8-3)20(5)16(21)13-9-10-18-12(4)19-13/h9-10,14-15H,6-8,11H2,1-5H3.
What are the key properties of N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide?
N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide has a molecular weight of 305.42 g/mol, XLogP of 2.84, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethoxy-2,2-diethylcyclobutyl)-N,2-dimethylpyrimidine-4-carboxamide is sourced from PubChem (CID 71975447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).