About 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol (PubChem CID 71976026) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol |
| PubChem CID | 71976026 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol |
| SMILES | COCC(C)(CCO)NCc1c(C)noc1C |
| InChI | InChI=1S/C12H22N2O3/c1-9-11(10(2)17-14-9)7-13-12(3,5-6-15)8-16-4/h13,15H,5-8H2,1-4H3 |
| InChIKey | HYJNTMSHBQURFP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol?
The IUPAC name of 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol (CID 71976026) is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol.
What is the SMILES notation for 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol?
The canonical SMILES for 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol is COCC(C)(CCO)NCc1c(C)noc1C.
What is the InChIKey of 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol?
The InChIKey is HYJNTMSHBQURFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-9-11(10(2)17-14-9)7-13-12(3,5-6-15)8-16-4/h13,15H,5-8H2,1-4H3.
What are the key properties of 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol?
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol has a molecular weight of 242.32 g/mol, XLogP of 1.17, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-4-methoxy-3-methylbutan-1-ol is sourced from PubChem (CID 71976026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).