About (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone
(7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone (PubChem CID 71976138) has the molecular formula C15H18ClNO2S
and a molecular weight of 311.83 g/mol. Its IUPAC name is (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone.
Molecular Properties
| Compound Name | (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone |
| PubChem CID | 71976138 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone |
| SMILES | O=C(C1CCOCC1)N1CCCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H18ClNO2S/c16-12-2-3-14-13(10-12)17(6-1-9-20-14)15(18)11-4-7-19-8-5-11/h2-3,10-11H,1,4-9H2 |
| InChIKey | PLTMYEMGXUDDBV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone?
The IUPAC name of (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone (CID 71976138) is (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone.
What is the SMILES notation for (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone?
The canonical SMILES for (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone is O=C(C1CCOCC1)N1CCCSc2ccc(Cl)cc21.
What is the InChIKey of (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone?
The InChIKey is PLTMYEMGXUDDBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClNO2S/c16-12-2-3-14-13(10-12)17(6-1-9-20-14)15(18)11-4-7-19-8-5-11/h2-3,10-11H,1,4-9H2.
What are the key properties of (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone?
(7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone has a molecular weight of 311.83 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-3,4-dihydro-2H-1,5-benzothiazepin-5-yl)-(oxan-4-yl)methanone is sourced from PubChem (CID 71976138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).