C14H18F4N2O — CID 71976318
N-[4-(dimethylamino)butan-2-yl]-2-fluoro-3-(trifluoromethyl)benzamide (PubChem CID 71976318) has the molecular formula C14H18F4N2O and a molecular weight of 306.30 g/mol. Its IUPAC name is N-[4-(dimethylamino)butan-2-yl]-2-fluoro-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(dimethylamino)butan-2-yl]-2-fluoro-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 71976318 |
| Molecular Formula | C14H18F4N2O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-[4-(dimethylamino)butan-2-yl]-2-fluoro-3-(trifluoromethyl)benzamide |
| SMILES | CC(CCN(C)C)NC(=O)c1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C14H18F4N2O/c1-9(7-8-20(2)3)19-13(21)10-5-4-6-11(12(10)15)14(16,17)18/h4-6,9H,7-8H2,1-3H3,(H,19,21) |
| InChIKey | YIICIDKPQBMJDZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |