About 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide
4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide (PubChem CID 7197654) has the molecular formula C12H20N4O4S
and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide |
| PubChem CID | 7197654 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide |
| SMILES | Cn1c(N)c(S(=O)(=O)NC2CCCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H20N4O4S/c1-15-10(13)9(11(17)16(2)12(15)18)21(19,20)14-8-6-4-3-5-7-8/h8,14H,3-7,13H2,1-2H3 |
| InChIKey | ZHMJNPZLALWITE-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide?
The IUPAC name of 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide (CID 7197654) is 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide.
What is the SMILES notation for 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide?
The canonical SMILES for 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide is Cn1c(N)c(S(=O)(=O)NC2CCCCC2)c(=O)n(C)c1=O.
What is the InChIKey of 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide?
The InChIKey is ZHMJNPZLALWITE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O4S/c1-15-10(13)9(11(17)16(2)12(15)18)21(19,20)14-8-6-4-3-5-7-8/h8,14H,3-7,13H2,1-2H3.
What are the key properties of 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide?
4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide has a molecular weight of 316.38 g/mol, XLogP of -0.72, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-cyclohexyl-1,3-dimethyl-2,6-dioxopyrimidine-5-sulfonamide is sourced from PubChem (CID 7197654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).