About N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide
N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide (PubChem CID 71976660) has the molecular formula C14H20FNO3S
and a molecular weight of 301.38 g/mol. Its IUPAC name is N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide |
| PubChem CID | 71976660 |
| Molecular Formula | C14H20FNO3S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide |
| SMILES | CCOc1cccc2c1CCC2NS(=O)(=O)CCCF |
| InChI | InChI=1S/C14H20FNO3S/c1-2-19-14-6-3-5-11-12(14)7-8-13(11)16-20(17,18)10-4-9-15/h3,5-6,13,16H,2,4,7-10H2,1H3 |
| InChIKey | IFDMJXROQFMIHU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide?
The IUPAC name of N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide (CID 71976660) is N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide.
What is the SMILES notation for N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide?
The canonical SMILES for N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide is CCOc1cccc2c1CCC2NS(=O)(=O)CCCF.
What is the InChIKey of N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide?
The InChIKey is IFDMJXROQFMIHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO3S/c1-2-19-14-6-3-5-11-12(14)7-8-13(11)16-20(17,18)10-4-9-15/h3,5-6,13,16H,2,4,7-10H2,1H3.
What are the key properties of N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide?
N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide has a molecular weight of 301.38 g/mol, XLogP of 2.35, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethoxy-2,3-dihydro-1H-inden-1-yl)-3-fluoropropane-1-sulfonamide is sourced from PubChem (CID 71976660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).