About N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide
N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide (PubChem CID 71976739) has the molecular formula C14H18N4O2S
and a molecular weight of 306.39 g/mol. Its IUPAC name is N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide |
| PubChem CID | 71976739 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide |
| SMILES | COC(C)c1nc(CN(C)C(=O)c2cnc(C)cn2)cs1 |
| InChI | InChI=1S/C14H18N4O2S/c1-9-5-16-12(6-15-9)14(19)18(3)7-11-8-21-13(17-11)10(2)20-4/h5-6,8,10H,7H2,1-4H3 |
| InChIKey | ICZOHELEKBLPFJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide?
The IUPAC name of N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide (CID 71976739) is N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide.
What is the SMILES notation for N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide?
The canonical SMILES for N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide is COC(C)c1nc(CN(C)C(=O)c2cnc(C)cn2)cs1.
What is the InChIKey of N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide?
The InChIKey is ICZOHELEKBLPFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2S/c1-9-5-16-12(6-15-9)14(19)18(3)7-11-8-21-13(17-11)10(2)20-4/h5-6,8,10H,7H2,1-4H3.
What are the key properties of N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide?
N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide has a molecular weight of 306.39 g/mol, XLogP of 2.22, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(1-methoxyethyl)-1,3-thiazol-4-yl]methyl]-N,5-dimethylpyrazine-2-carboxamide is sourced from PubChem (CID 71976739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).