C18H19N3O3 — CID 71977444
1-[2-(4-benzylidenepiperidin-1-yl)-2-oxoethyl]pyrimidine-2,4-dione (PubChem CID 71977444) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 1-[2-(4-benzylidenepiperidin-1-yl)-2-oxoethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-(4-benzylidenepiperidin-1-yl)-2-oxoethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71977444 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 1-[2-(4-benzylidenepiperidin-1-yl)-2-oxoethyl]pyrimidine-2,4-dione |
| SMILES | O=C(Cn1ccc(=O)[nH]c1=O)N1CCC(=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H19N3O3/c22-16-8-11-21(18(24)19-16)13-17(23)20-9-6-15(7-10-20)12-14-4-2-1-3-5-14/h1-5,8,11-12H,6-7,9-10,13H2,(H,19,22,24) |
| InChIKey | VLQSJLPILVTHOO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |