C15H26N4O2S — CID 71978146
N-[[1-(2-tert-butylpyrimidin-4-yl)piperidin-2-yl]methyl]methanesulfonamide (PubChem CID 71978146) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is N-[[1-(2-tert-butylpyrimidin-4-yl)piperidin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-(2-tert-butylpyrimidin-4-yl)piperidin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 71978146 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N-[[1-(2-tert-butylpyrimidin-4-yl)piperidin-2-yl]methyl]methanesulfonamide |
| SMILES | CC(C)(C)c1nccc(N2CCCCC2CNS(C)(=O)=O)n1 |
| InChI | InChI=1S/C15H26N4O2S/c1-15(2,3)14-16-9-8-13(18-14)19-10-6-5-7-12(19)11-17-22(4,20)21/h8-9,12,17H,5-7,10-11H2,1-4H3 |
| InChIKey | BJVPSLFFCQELAQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |