C15H16ClN3O2S — CID 71978167
5-chloro-2-[[2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]amino]benzamide (PubChem CID 71978167) has the molecular formula C15H16ClN3O2S and a molecular weight of 337.83 g/mol. Its IUPAC name is 5-chloro-2-[[2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]amino]benzamide.
| Compound Name | 5-chloro-2-[[2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 71978167 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 5-chloro-2-[[2-[methyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]amino]benzamide |
| SMILES | CN(Cc1cccs1)C(=O)CNc1ccc(Cl)cc1C(N)=O |
| InChI | InChI=1S/C15H16ClN3O2S/c1-19(9-11-3-2-6-22-11)14(20)8-18-13-5-4-10(16)7-12(13)15(17)21/h2-7,18H,8-9H2,1H3,(H2,17,21) |
| InChIKey | CBQNQQAKGUSBHY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |