C15H19F4N3O2 — CID 71979423
(3-ethoxy-2-pyridinyl)-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone (PubChem CID 71979423) has the molecular formula C15H19F4N3O2 and a molecular weight of 349.33 g/mol. Its IUPAC name is (3-ethoxy-2-pyridinyl)-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone.
| Compound Name | (3-ethoxy-2-pyridinyl)-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 71979423 |
| Molecular Formula | C15H19F4N3O2 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (3-ethoxy-2-pyridinyl)-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]methanone |
| SMILES | CCOc1cccnc1C(=O)N1CCN(CC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C15H19F4N3O2/c1-2-24-11-4-3-5-20-12(11)13(23)22-8-6-21(7-9-22)10-15(18,19)14(16)17/h3-5,14H,2,6-10H2,1H3 |
| InChIKey | BIBDXIXGRJAHEP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|