About 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione
4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 719799) has the molecular formula C9H9N3S
and a molecular weight of 191.26 g/mol. Its IUPAC name is 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione.
Molecular Properties
| Compound Name | 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione |
| PubChem CID | 719799 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(-c2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C9H9N3S/c1-12-8(10-11-9(12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,11,13) |
| InChIKey | XGLHJEZLNGXEAZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione?
The IUPAC name of 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione (CID 719799) is 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione.
What is the SMILES notation for 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione?
The canonical SMILES for 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione is Cn1c(-c2ccccc2)n[nH]c1=S.
What is the InChIKey of 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione?
The InChIKey is XGLHJEZLNGXEAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3S/c1-12-8(10-11-9(12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,11,13).
What are the key properties of 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione?
4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione has a molecular weight of 191.26 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-phenyl-1H-1,2,4-triazole-5-thione is sourced from PubChem (CID 719799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).