C14H22N2O3S — CID 71980379
3-cyclohexyl-5-(1-methylsulfonylcyclopentyl)-1,2,4-oxadiazole (PubChem CID 71980379) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-cyclohexyl-5-(1-methylsulfonylcyclopentyl)-1,2,4-oxadiazole.
| Compound Name | 3-cyclohexyl-5-(1-methylsulfonylcyclopentyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 71980379 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-cyclohexyl-5-(1-methylsulfonylcyclopentyl)-1,2,4-oxadiazole |
| SMILES | CS(=O)(=O)C1(c2nc(C3CCCCC3)no2)CCCC1 |
| InChI | InChI=1S/C14H22N2O3S/c1-20(17,18)14(9-5-6-10-14)13-15-12(16-19-13)11-7-3-2-4-8-11/h11H,2-10H2,1H3 |
| InChIKey | CTHZUVOJKQHROJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |