C13H14ClF3N2O3 — CID 71980701
N-(3-chloro-2-methoxyphenyl)-3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-carboxamide (PubChem CID 71980701) has the molecular formula C13H14ClF3N2O3 and a molecular weight of 338.71 g/mol. Its IUPAC name is N-(3-chloro-2-methoxyphenyl)-3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3-chloro-2-methoxyphenyl)-3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71980701 |
| Molecular Formula | C13H14ClF3N2O3 |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-(3-chloro-2-methoxyphenyl)-3-hydroxy-3-(trifluoromethyl)pyrrolidine-1-carboxamide |
| SMILES | COc1c(Cl)cccc1NC(=O)N1CCC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H14ClF3N2O3/c1-22-10-8(14)3-2-4-9(10)18-11(20)19-6-5-12(21,7-19)13(15,16)17/h2-4,21H,5-7H2,1H3,(H,18,20) |
| InChIKey | SLTGBGRWMMQUPY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |